C32H57NO4 — CID 70544595
methyl (8S,9R,10S,13S,14S)-2-hexoxy-3-hydroxy-10,13-dimethyl-11-(3-methylbutylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 70544595) has the molecular formula C32H57NO4 and a molecular weight of 519.81 g/mol. Its IUPAC name is methyl (8S,9R,10S,13S,14S)-2-hexoxy-3-hydroxy-10,13-dimethyl-11-(3-methylbutylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (8S,9R,10S,13S,14S)-2-hexoxy-3-hydroxy-10,13-dimethyl-11-(3-methylbutylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 70544595 |
| Molecular Formula | C32H57NO4 |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 519.43 |
| IUPAC Name | methyl (8S,9R,10S,13S,14S)-2-hexoxy-3-hydroxy-10,13-dimethyl-11-(3-methylbutylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CCCCCCOC1C[C@@]2(C)C(CC[C@@H]3[C@H]2C(NCCC(C)C)C[C@]2(C)C(C(=O)OC)CC[C@@H]32)CC1O |
| InChI | InChI=1S/C32H57NO4/c1-7-8-9-10-17-37-28-20-31(4)22(18-27(28)34)11-12-23-24-13-14-25(30(35)36-6)32(24,5)19-26(29(23)31)33-16-15-21(2)3/h21-29,33-34H,7-20H2,1-6H3/t22?,23-,24-,25?,26?,27?,28?,29-,31-,32-/m0/s1 |
| InChIKey | AIDMNZVGFDOKPG-WAEQLWMISA-N |
| XLogP | 6.37 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|