C30H49NO5 — CID 86736868
[(3R,5S,8S,9S,10S,11S,13S,14S,17S)-17-acetyl-3-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] 2-(dipropylamino)acetate (PubChem CID 86736868) has the molecular formula C30H49NO5 and a molecular weight of 503.72 g/mol. Its IUPAC name is [(3R,5S,8S,9S,10S,11S,13S,14S,17S)-17-acetyl-3-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] 2-(dipropylamino)acetate.
| Compound Name | [(3R,5S,8S,9S,10S,11S,13S,14S,17S)-17-acetyl-3-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] 2-(dipropylamino)acetate |
|---|---|
| PubChem CID | 86736868 |
| Molecular Formula | C30H49NO5 |
| Molecular Weight | 503.72 g/mol |
| Exact Mass | 503.36 |
| IUPAC Name | [(3R,5S,8S,9S,10S,11S,13S,14S,17S)-17-acetyl-3-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] 2-(dipropylamino)acetate |
| SMILES | CCCN(CCC)CC(=O)O[C@H]1C[C@]2(C)[C@@H](C(C)=O)CC[C@H]2[C@@H]2CC[C@H]3C[C@H](OC=O)CC[C@]3(C)[C@H]21 |
| InChI | InChI=1S/C30H49NO5/c1-6-14-31(15-7-2)18-27(34)36-26-17-30(5)24(20(3)33)10-11-25(30)23-9-8-21-16-22(35-19-32)12-13-29(21,4)28(23)26/h19,21-26,28H,6-18H2,1-5H3/t21-,22+,23-,24+,25-,26-,28+,29-,30+/m0/s1 |
| InChIKey | PYCOWWQLOFCEPX-HLIAJOSUSA-N |
| XLogP | 5.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.72 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|