C25H45NO2Si — CID 91750584
1-[(5S,10S,11S,13S,17S)-10,13-dimethyl-11-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine (PubChem CID 91750584) has the molecular formula C25H45NO2Si and a molecular weight of 419.73 g/mol. Its IUPAC name is 1-[(5S,10S,11S,13S,17S)-10,13-dimethyl-11-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine.
| Compound Name | 1-[(5S,10S,11S,13S,17S)-10,13-dimethyl-11-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 91750584 |
| Molecular Formula | C25H45NO2Si |
| Molecular Weight | 419.73 g/mol |
| Exact Mass | 419.32 |
| IUPAC Name | 1-[(5S,10S,11S,13S,17S)-10,13-dimethyl-11-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine |
| SMILES | CON=C(C)[C@H]1CCC2C3CC[C@@H]4CCCC[C@]4(C)C3C(O[Si](C)(C)C)C[C@@]21C |
| InChI | InChI=1S/C25H45NO2Si/c1-17(26-27-4)20-13-14-21-19-12-11-18-10-8-9-15-24(18,2)23(19)22(16-25(20,21)3)28-29(5,6)7/h18-23H,8-16H2,1-7H3/t18-,19?,20+,21?,22?,23?,24-,25+/m0/s1 |
| InChIKey | RVFWFCRECYIUFJ-JJMLJACESA-N |
| XLogP | 6.89 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.73 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|