C28H53NO3Si2 — CID 91750106
(E)-1-[(3R,5S,10S,11S,13S,17S)-10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine (PubChem CID 91750106) has the molecular formula C28H53NO3Si2 and a molecular weight of 507.91 g/mol. Its IUPAC name is (E)-1-[(3R,5S,10S,11S,13S,17S)-10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine.
| Compound Name | (E)-1-[(3R,5S,10S,11S,13S,17S)-10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 91750106 |
| Molecular Formula | C28H53NO3Si2 |
| Molecular Weight | 507.91 g/mol |
| Exact Mass | 507.36 |
| IUPAC Name | (E)-1-[(3R,5S,10S,11S,13S,17S)-10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine |
| SMILES | CO/N=C(\C)[C@H]1CCC2C3CC[C@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)C3C(O[Si](C)(C)C)C[C@@]21C |
| InChI | InChI=1S/C28H53NO3Si2/c1-19(29-30-4)23-13-14-24-22-12-11-20-17-21(31-33(5,6)7)15-16-27(20,2)26(22)25(18-28(23,24)3)32-34(8,9)10/h20-26H,11-18H2,1-10H3/b29-19+/t20-,21+,22?,23+,24?,25?,26?,27-,28+/m0/s1 |
| InChIKey | ZGXYWFUBLPJGKA-FYXNKWLTSA-N |
| XLogP | 7.72 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.91 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|