C26H46N2O3Si — CID 552711
N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-11-trimethylsilyloxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-imine (PubChem CID 552711) has the molecular formula C26H46N2O3Si and a molecular weight of 462.75 g/mol. Its IUPAC name is N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-11-trimethylsilyloxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-imine.
| Compound Name | N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-11-trimethylsilyloxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 552711 |
| Molecular Formula | C26H46N2O3Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-11-trimethylsilyloxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-imine |
| SMILES | CON=C1CCC2(C)C(CCC3C4CCC(C(C)=NOC)C4(C)CC(O[Si](C)(C)C)C32)C1 |
| InChI | InChI=1S/C26H46N2O3Si/c1-17(27-29-4)21-11-12-22-20-10-9-18-15-19(28-30-5)13-14-25(18,2)24(20)23(16-26(21,22)3)31-32(6,7)8/h18,20-24H,9-16H2,1-8H3 |
| InChIKey | OIUIKIGMQBHOGR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|