C26H44N2O3Si — CID 91750542
(3S,10R,13S,17S)-N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-3-trimethylsilyloxy-1,2,3,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-imine (PubChem CID 91750542) has the molecular formula C26H44N2O3Si and a molecular weight of 460.74 g/mol. Its IUPAC name is (3S,10R,13S,17S)-N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-3-trimethylsilyloxy-1,2,3,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-imine.
| Compound Name | (3S,10R,13S,17S)-N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-3-trimethylsilyloxy-1,2,3,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-imine |
|---|---|
| PubChem CID | 91750542 |
| Molecular Formula | C26H44N2O3Si |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | (3S,10R,13S,17S)-N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-3-trimethylsilyloxy-1,2,3,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-imine |
| SMILES | CON=C1C[C@@]2(C)C(CC[C@@H]2C(C)=NOC)C2CCC3=C[C@@H](O[Si](C)(C)C)CC[C@]3(C)C12 |
| InChI | InChI=1S/C26H44N2O3Si/c1-17(27-29-4)21-11-12-22-20-10-9-18-15-19(31-32(6,7)8)13-14-25(18,2)24(20)23(28-30-5)16-26(21,22)3/h15,19-22,24H,9-14,16H2,1-8H3/t19-,20?,21+,22?,24?,25-,26+/m0/s1 |
| InChIKey | ZRSFJLPCGOXQFX-ARPZOEFLSA-N |
| XLogP | 6.42 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|