C23H34N2O5 — CID 71440103
2-hydroxy-1-[17-hydroxy-3,11-bis(methoxyimino)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 71440103) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is 2-hydroxy-1-[17-hydroxy-3,11-bis(methoxyimino)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-hydroxy-1-[17-hydroxy-3,11-bis(methoxyimino)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 71440103 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2-hydroxy-1-[17-hydroxy-3,11-bis(methoxyimino)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CON=C1C=C2CCC3C(C(=NOC)CC4(C)C3CCC4(O)C(=O)CO)C2(C)CC1 |
| InChI | InChI=1S/C23H34N2O5/c1-21-9-7-15(24-29-3)11-14(21)5-6-16-17-8-10-23(28,19(27)13-26)22(17,2)12-18(20(16)21)25-30-4/h11,16-17,20,26,28H,5-10,12-13H2,1-4H3 |
| InChIKey | RYMFWQCUJITHAE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|