C22H30N2O4 — CID 142968317
(8S,10R,13S,17R)-3-amino-17-hydroxy-17-(2-hydroxyacetyl)-2-methanimidoyl-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-one (PubChem CID 142968317) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is (8S,10R,13S,17R)-3-amino-17-hydroxy-17-(2-hydroxyacetyl)-2-methanimidoyl-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-one.
| Compound Name | (8S,10R,13S,17R)-3-amino-17-hydroxy-17-(2-hydroxyacetyl)-2-methanimidoyl-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 142968317 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (8S,10R,13S,17R)-3-amino-17-hydroxy-17-(2-hydroxyacetyl)-2-methanimidoyl-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-one |
| SMILES | [H]/N=C/C1=C(N)C=C2CC[C@@H]3C(C(=O)C[C@@]4(C)C3CC[C@]4(O)C(=O)CO)[C@@]2(C)C1 |
| InChI | InChI=1S/C22H30N2O4/c1-20-8-12(10-23)16(24)7-13(20)3-4-14-15-5-6-22(28,18(27)11-25)21(15,2)9-17(26)19(14)20/h7,10,14-15,19,23,25,28H,3-6,8-9,11,24H2,1-2H3/b23-10+/t14-,15?,19?,20-,21-,22-/m0/s1 |
| InChIKey | RSNAVHRRDICIMC-CFGXBDFPSA-N |
| XLogP | 1.89 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|