C24H38N2O4 — CID 142962766
1-[(17R)-3-amino-11,17-dihydroxy-2-methanimidoyl-10,13-dimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-hydroxyethanone;ethane (PubChem CID 142962766) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is 1-[(17R)-3-amino-11,17-dihydroxy-2-methanimidoyl-10,13-dimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-hydroxyethanone;ethane.
| Compound Name | 1-[(17R)-3-amino-11,17-dihydroxy-2-methanimidoyl-10,13-dimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-hydroxyethanone;ethane |
|---|---|
| PubChem CID | 142962766 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 1-[(17R)-3-amino-11,17-dihydroxy-2-methanimidoyl-10,13-dimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-hydroxyethanone;ethane |
| SMILES | CC.[H]/N=C/C1=C(N)C=C2CCC3C(C(O)CC4(C)C3CC[C@]4(O)C(=O)CO)C2(C)C1 |
| InChI | InChI=1S/C22H32N2O4.C2H6/c1-20-8-12(10-23)16(24)7-13(20)3-4-14-15-5-6-22(28,18(27)11-25)21(15,2)9-17(26)19(14)20;1-2/h7,10,14-15,17,19,23,25-26,28H,3-6,8-9,11,24H2,1-2H3;1-2H3/b23-10+;/t14?,15?,17?,19?,20?,21?,22-;/m0./s1 |
| InChIKey | TXKLXFGDHBSKGZ-XVQAQJCVSA-N |
| XLogP | 2.71 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|