C20H30BO4 — CID 54517873
CID 54517873 (PubChem CID 54517873) has the molecular formula C20H30BO4 and a molecular weight of 345.27 g/mol.
| Compound Name | CID 54517873 |
|---|---|
| PubChem CID | 54517873 |
| Molecular Formula | C20H30BO4 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | — |
| SMILES | CC12CC[B]C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO |
| InChI | InChI=1S/C20H30BO4/c1-18-7-8-21-10-12(18)3-4-13-14-5-6-20(25,16(24)11-22)19(14,2)9-15(23)17(13)18/h10,13-15,17,22-23,25H,3-9,11H2,1-2H3 |
| InChIKey | JLCQOGQOVFOCGF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|