C21H29O8P — CID 174978852
[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]phosphonic acid (PubChem CID 174978852) has the molecular formula C21H29O8P and a molecular weight of 440.43 g/mol. Its IUPAC name is [(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]phosphonic acid.
| Compound Name | [(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 174978852 |
| Molecular Formula | C21H29O8P |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | [(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl]phosphonic acid |
| SMILES | C[C@@]12C(=CC(=O)C=C1P(=O)(O)O)CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO |
| InChI | InChI=1S/C21H29O8P/c1-19-9-15(24)18-13(14(19)5-6-21(19,26)16(25)10-22)4-3-11-7-12(23)8-17(20(11,18)2)30(27,28)29/h7-8,13-15,18,22,24,26H,3-6,9-10H2,1-2H3,(H2,27,28,29)/t13-,14-,15-,18+,19-,20+,21-/m0/s1 |
| InChIKey | SQQYSTSBNSTNKB-JWMJEUPZSA-N |
| XLogP | 1.06 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|