C46H62O14 — CID 66604313
butanedioic acid;bis((8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one) (PubChem CID 66604313) has the molecular formula C46H62O14 and a molecular weight of 838.99 g/mol. Its IUPAC name is butanedioic acid;bis((8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one).
| Compound Name | butanedioic acid;bis((8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one) |
|---|---|
| PubChem CID | 66604313 |
| Molecular Formula | C46H62O14 |
| Molecular Weight | 838.99 g/mol |
| Exact Mass | 838.41 |
| IUPAC Name | butanedioic acid;bis((8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one) |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO.C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO.O=C(O)CCC(=O)O |
| InChI | InChI=1S/2C21H28O5.C4H6O4/c2*1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19;5-3(6)1-2-4(7)8/h2*5,7,9,14-16,18,22,24,26H,3-4,6,8,10-11H2,1-2H3;1-2H2,(H,5,6)(H,7,8)/t2*14-,15-,16-,18+,19-,20-,21-;/m00./s1 |
| InChIKey | GSJJBUPMPPXFSU-ITEUXIDFSA-N |
| XLogP | 3.05 |
| TPSA | 264.26 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.99 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |