C28H42O5 — CID 145129301
(17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one;methylcyclohexane (PubChem CID 145129301) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is (17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one;methylcyclohexane.
| Compound Name | (17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one;methylcyclohexane |
|---|---|
| PubChem CID | 145129301 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | (17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one;methylcyclohexane |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)CO.CC1CCCCC1 |
| InChI | InChI=1S/C21H28O5.C7H14/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19;1-7-5-3-2-4-6-7/h5,7,9,14-16,18,22,24,26H,3-4,6,8,10-11H2,1-2H3;7H,2-6H2,1H3/t14?,15?,16?,18?,19?,20?,21-;/m0./s1 |
| InChIKey | UQUABPXCVFZLMS-AYUWCVBUSA-N |
| XLogP | 4.14 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |