C22H30O4 — CID 162304087
17-hydroxy-17-(2-hydroxyacetyl)-10,11,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 162304087) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 17-hydroxy-17-(2-hydroxyacetyl)-10,11,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-hydroxy-17-(2-hydroxyacetyl)-10,11,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162304087 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 17-hydroxy-17-(2-hydroxyacetyl)-10,11,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1CC2(C)C(CCC2(O)C(=O)CO)C2CCC3=CC(=O)C=CC3(C)C12 |
| InChI | InChI=1S/C22H30O4/c1-13-11-21(3)17(7-9-22(21,26)18(25)12-23)16-5-4-14-10-15(24)6-8-20(14,2)19(13)16/h6,8,10,13,16-17,19,23,26H,4-5,7,9,11-12H2,1-3H3 |
| InChIKey | POIDWXYVKKBQFR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |