C23H38N2O2 — CID 91750544
(5R,10S,13S,17S)-N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-imine (PubChem CID 91750544) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is (5R,10S,13S,17S)-N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-imine.
| Compound Name | (5R,10S,13S,17S)-N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-imine |
|---|---|
| PubChem CID | 91750544 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | (5R,10S,13S,17S)-N-methoxy-17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-imine |
| SMILES | CON=C1C[C@@]2(C)C(CC[C@@H]2C(C)=NOC)C2CC[C@H]3CCCC[C@]3(C)C12 |
| InChI | InChI=1S/C23H38N2O2/c1-15(24-26-4)18-11-12-19-17-10-9-16-8-6-7-13-22(16,2)21(17)20(25-27-5)14-23(18,19)3/h16-19,21H,6-14H2,1-5H3/t16-,17?,18-,19?,21?,22+,23-/m1/s1 |
| InChIKey | MZWPWOPEEMZKBQ-YIOAUNFUSA-N |
| XLogP | 5.67 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|