C21H35NO — CID 172928379
(E,5R,8R,9S,10S,13R,14S)-N-ethoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,16,17-tetradecahydrocyclopenta[a]phenanthren-15-imine (PubChem CID 172928379) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (E,5R,8R,9S,10S,13R,14S)-N-ethoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,16,17-tetradecahydrocyclopenta[a]phenanthren-15-imine.
| Compound Name | (E,5R,8R,9S,10S,13R,14S)-N-ethoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,16,17-tetradecahydrocyclopenta[a]phenanthren-15-imine |
|---|---|
| PubChem CID | 172928379 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (E,5R,8R,9S,10S,13R,14S)-N-ethoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,16,17-tetradecahydrocyclopenta[a]phenanthren-15-imine |
| SMILES | CCO/N=C1\CC[C@@]2(C)CC[C@H]3[C@@H](CC[C@H]4CCCC[C@@]43C)[C@H]12 |
| InChI | InChI=1S/C21H35NO/c1-4-23-22-18-11-14-20(2)13-10-17-16(19(18)20)9-8-15-7-5-6-12-21(15,17)3/h15-17,19H,4-14H2,1-3H3/b22-18+/t15-,16-,17+,19-,20-,21+/m1/s1 |
| InChIKey | VVOTWPGHNHMJAW-LFDOHEEQSA-N |
| XLogP | 5.81 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|