C19H32N2 — CID 125028783
(Z)-[(5R,8S,9R,10R,13S,14R)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]hydrazine (PubChem CID 125028783) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is (Z)-[(5R,8S,9R,10R,13S,14R)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]hydrazine.
| Compound Name | (Z)-[(5R,8S,9R,10R,13S,14R)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]hydrazine |
|---|---|
| PubChem CID | 125028783 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | (Z)-[(5R,8S,9R,10R,13S,14R)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]hydrazine |
| SMILES | C[C@@]12CCCC[C@@H]1CC[C@H]1[C@H]2CC[C@]2(C)/C(=N\N)CC[C@H]12 |
| InChI | InChI=1S/C19H32N2/c1-18-11-4-3-5-13(18)6-7-14-15-8-9-17(21-20)19(15,2)12-10-16(14)18/h13-16H,3-12,20H2,1-2H3/b21-17-/t13-,14-,15-,16-,18-,19+/m1/s1 |
| InChIKey | OTWRKZRQJVDSJI-HJTMCDOSSA-N |
| XLogP | 4.73 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|