C25H41N — CID 124906078
(5R,8S,9R,10S,13S,14S)-N-cyclohexyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine (PubChem CID 124906078) has the molecular formula C25H41N and a molecular weight of 355.61 g/mol. Its IUPAC name is (5R,8S,9R,10S,13S,14S)-N-cyclohexyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine.
| Compound Name | (5R,8S,9R,10S,13S,14S)-N-cyclohexyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine |
|---|---|
| PubChem CID | 124906078 |
| Molecular Formula | C25H41N |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | (5R,8S,9R,10S,13S,14S)-N-cyclohexyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@H]1[C@H]2CC[C@]2(C)/C(=N/C3CCCCC3)CC[C@@H]12 |
| InChI | InChI=1S/C25H41N/c1-24-16-7-6-8-18(24)11-12-20-21-13-14-23(25(21,2)17-15-22(20)24)26-19-9-4-3-5-10-19/h18-22H,3-17H2,1-2H3/b26-23+/t18-,20-,21+,22-,24+,25+/m1/s1 |
| InChIKey | UBVDQPPYMIRBTH-YTHSPHAESA-N |
| XLogP | 7.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|