C20H33N3S — CID 71834069
[(10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene)amino]thiourea (PubChem CID 71834069) has the molecular formula C20H33N3S and a molecular weight of 347.57 g/mol. Its IUPAC name is [(10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene)amino]thiourea.
| Compound Name | [(10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 71834069 |
| Molecular Formula | C20H33N3S |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | [(10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene)amino]thiourea |
| SMILES | CC12CCC3C(CCC4CCCCC43C)C1CCC2=NNC(N)=S |
| InChI | InChI=1S/C20H33N3S/c1-19-11-4-3-5-13(19)6-7-14-15-8-9-17(22-23-18(21)24)20(15,2)12-10-16(14)19/h13-16H,3-12H2,1-2H3,(H3,21,23,24) |
| InChIKey | OXZJZRQUDLKMGF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|