C21H34N6S2 — CID 124905655
[[(5S,8S,9R,10S,13S,14S)-3-(carbamothioylhydrazinylidene)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]amino]thiourea (PubChem CID 124905655) has the molecular formula C21H34N6S2 and a molecular weight of 434.68 g/mol. Its IUPAC name is [[(5S,8S,9R,10S,13S,14S)-3-(carbamothioylhydrazinylidene)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]amino]thiourea.
| Compound Name | [[(5S,8S,9R,10S,13S,14S)-3-(carbamothioylhydrazinylidene)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 124905655 |
| Molecular Formula | C21H34N6S2 |
| Molecular Weight | 434.68 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [[(5S,8S,9R,10S,13S,14S)-3-(carbamothioylhydrazinylidene)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]amino]thiourea |
| SMILES | C[C@]12CCC(=NNC(N)=S)C[C@@H]1CC[C@H]1[C@H]2CC[C@]2(C)C(=NNC(N)=S)CC[C@@H]12 |
| InChI | InChI=1S/C21H34N6S2/c1-20-9-7-13(24-26-18(22)28)11-12(20)3-4-14-15-5-6-17(25-27-19(23)29)21(15,2)10-8-16(14)20/h12,14-16H,3-11H2,1-2H3,(H3,22,26,28)(H3,23,27,29)/t12-,14+,15-,16+,20-,21-/m0/s1 |
| InChIKey | MEXIFKWHLHNKJI-ZUPCMDOMSA-N |
| XLogP | 3.41 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|