C44H70N4O4 — CID 172934815
N,N'-bis[(E)-(17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene)amino]hexanediamide (PubChem CID 172934815) has the molecular formula C44H70N4O4 and a molecular weight of 719.07 g/mol. Its IUPAC name is N,N'-bis[(E)-(17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene)amino]hexanediamide.
| Compound Name | N,N'-bis[(E)-(17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene)amino]hexanediamide |
|---|---|
| PubChem CID | 172934815 |
| Molecular Formula | C44H70N4O4 |
| Molecular Weight | 719.07 g/mol |
| Exact Mass | 718.54 |
| IUPAC Name | N,N'-bis[(E)-(17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene)amino]hexanediamide |
| SMILES | CC12CCC3C(CCC4C/C(=N/NC(=O)CCCCC(=O)N/N=C5\CCC6(C)C(CCC7C8CCC(O)C8(C)CCC76)C5)CCC43C)C1CCC2O |
| InChI | InChI=1S/C44H70N4O4/c1-41-21-17-29(25-27(41)9-11-31-33-13-15-37(49)43(33,3)23-19-35(31)41)45-47-39(51)7-5-6-8-40(52)48-46-30-18-22-42(2)28(26-30)10-12-32-34-14-16-38(50)44(34,4)24-20-36(32)42/h27-28,31-38,49-50H,5-26H2,1-4H3,(H,47,51)(H,48,52)/b45-29+,46-30+ |
| InChIKey | PYYXHHBYOQWWNZ-PGZMIIDGSA-N |
| XLogP | 8.30 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.07 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|