C23H38N2O2 — CID 91750562
(5S,10S,13R,17S)-17-ethyl-3-N,11-N-dimethoxy-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diimine (PubChem CID 91750562) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is (5S,10S,13R,17S)-17-ethyl-3-N,11-N-dimethoxy-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diimine.
| Compound Name | (5S,10S,13R,17S)-17-ethyl-3-N,11-N-dimethoxy-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diimine |
|---|---|
| PubChem CID | 91750562 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | (5S,10S,13R,17S)-17-ethyl-3-N,11-N-dimethoxy-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diimine |
| SMILES | CC[C@H]1CCC2C3CC[C@H]4CC(=NOC)CC[C@]4(C)C3C(=NOC)C[C@@]21C |
| InChI | InChI=1S/C23H38N2O2/c1-6-15-8-10-19-18-9-7-16-13-17(24-26-4)11-12-22(16,2)21(18)20(25-27-5)14-23(15,19)3/h15-16,18-19,21H,6-14H2,1-5H3/t15-,16-,18?,19?,21?,22-,23+/m0/s1 |
| InChIKey | ACPIXOASZHBQJM-GOFRRPGKSA-N |
| XLogP | 5.67 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|