C22H37NO — CID 91750578
(5S,10S,13R,17S)-17-ethyl-N-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-imine (PubChem CID 91750578) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is (5S,10S,13R,17S)-17-ethyl-N-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-imine.
| Compound Name | (5S,10S,13R,17S)-17-ethyl-N-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 91750578 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | (5S,10S,13R,17S)-17-ethyl-N-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-imine |
| SMILES | CC[C@H]1CCC2C3CC[C@H]4CC(=NOC)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C22H37NO/c1-5-15-7-9-19-18-8-6-16-14-17(23-24-4)10-12-22(16,3)20(18)11-13-21(15,19)2/h15-16,18-20H,5-14H2,1-4H3/t15-,16-,18?,19?,20?,21+,22-/m0/s1 |
| InChIKey | BPMVIIIFXZWLED-CQOVQRJPSA-N |
| XLogP | 6.06 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|