C22H38 — CID 173313669
(8S,9R,10S,13R,14S,17S)-17-ethyl-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 173313669) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,17S)-17-ethyl-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14S,17S)-17-ethyl-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 173313669 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | (8S,9R,10S,13R,14S,17S)-17-ethyl-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCC4CC(C)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C22H38/c1-5-16-7-9-19-18-8-6-17-14-15(2)10-12-22(17,4)20(18)11-13-21(16,19)3/h15-20H,5-14H2,1-4H3/t15?,16-,17?,18-,19-,20+,21+,22-/m0/s1 |
| InChIKey | QTOZCKJQONLQSG-AQKZFGPASA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |