C26H46O — CID 123555643
5-[(8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]pentan-1-ol (PubChem CID 123555643) has the molecular formula C26H46O and a molecular weight of 374.65 g/mol. Its IUPAC name is 5-[(8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]pentan-1-ol.
| Compound Name | 5-[(8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]pentan-1-ol |
|---|---|
| PubChem CID | 123555643 |
| Molecular Formula | C26H46O |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 374.35 |
| IUPAC Name | 5-[(8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]pentan-1-ol |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCC4CC(CCCCCO)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H46O/c1-4-20-10-12-23-22-11-9-21-18-19(8-6-5-7-17-27)13-15-26(21,3)24(22)14-16-25(20,23)2/h19-24,27H,4-18H2,1-3H3/t19?,20-,21?,22-,23-,24-,25+,26-/m0/s1 |
| InChIKey | YVMDIJSHDFWMDY-LDDNKCFESA-N |
| XLogP | 7.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|