C29H54O — CID 171642880
(3S,5R,8S,10S,13R)-3-ethyl-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methanol (PubChem CID 171642880) has the molecular formula C29H54O and a molecular weight of 418.75 g/mol. Its IUPAC name is (3S,5R,8S,10S,13R)-3-ethyl-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methanol.
| Compound Name | (3S,5R,8S,10S,13R)-3-ethyl-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methanol |
|---|---|
| PubChem CID | 171642880 |
| Molecular Formula | C29H54O |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 418.42 |
| IUPAC Name | (3S,5R,8S,10S,13R)-3-ethyl-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methanol |
| SMILES | CC[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(CCCCC(C)C)CCC4[C@@H]3CC[C@@H]2C1.CO |
| InChI | InChI=1S/C28H50.CH4O/c1-6-21-15-17-28(5)23(19-21)11-13-24-25-14-12-22(10-8-7-9-20(2)3)27(25,4)18-16-26(24)28;1-2/h20-26H,6-19H2,1-5H3;2H,1H3/t21-,22?,23+,24-,25?,26?,27+,28-;/m0./s1 |
| InChIKey | WZENNSVTXOBWBS-FWAAVFRNSA-N |
| XLogP | 8.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|