C36H65NO2 — CID 142283081
5-[ethyl(methyl)amino]-2-methylidenepentanal;3-methoxy-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 142283081) has the molecular formula C36H65NO2 and a molecular weight of 543.92 g/mol. Its IUPAC name is 5-[ethyl(methyl)amino]-2-methylidenepentanal;3-methoxy-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 5-[ethyl(methyl)amino]-2-methylidenepentanal;3-methoxy-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 142283081 |
| Molecular Formula | C36H65NO2 |
| Molecular Weight | 543.92 g/mol |
| Exact Mass | 543.50 |
| IUPAC Name | 5-[ethyl(methyl)amino]-2-methylidenepentanal;3-methoxy-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=C(C=O)CCCN(C)CC.COC1CCC2(C)C(CCC3C4CCC(CCCCC(C)C)C4(C)CCC32)C1 |
| InChI | InChI=1S/C27H48O.C9H17NO/c1-19(2)8-6-7-9-20-11-13-24-23-12-10-21-18-22(28-5)14-16-27(21,4)25(23)15-17-26(20,24)3;1-4-10(3)7-5-6-9(2)8-11/h19-25H,6-18H2,1-5H3;8H,2,4-7H2,1,3H3 |
| InChIKey | UZUOCMVKJLRBGV-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.92 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|