C26H43NO4 — CID 155211751
formamido (4R)-4-[(3R,8R,9S,10S,13R,14S,17R)-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 155211751) has the molecular formula C26H43NO4 and a molecular weight of 433.63 g/mol. Its IUPAC name is formamido (4R)-4-[(3R,8R,9S,10S,13R,14S,17R)-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | formamido (4R)-4-[(3R,8R,9S,10S,13R,14S,17R)-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 155211751 |
| Molecular Formula | C26H43NO4 |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | formamido (4R)-4-[(3R,8R,9S,10S,13R,14S,17R)-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CO[C@@H]1CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCC(=O)ONC=O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H43NO4/c1-17(5-10-24(29)31-27-16-28)21-8-9-22-20-7-6-18-15-19(30-4)11-13-25(18,2)23(20)12-14-26(21,22)3/h16-23H,5-15H2,1-4H3,(H,27,28)/t17-,18?,19-,20+,21-,22+,23+,25+,26-/m1/s1 |
| InChIKey | WRLFKASPDCKRBI-VUVRTVETSA-N |
| XLogP | 5.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|