C43H76O3 — CID 176937209
octadec-9-enyl (4R)-4-[(3R,10S,13R)-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 176937209) has the molecular formula C43H76O3 and a molecular weight of 641.08 g/mol. Its IUPAC name is octadec-9-enyl (4R)-4-[(3R,10S,13R)-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | octadec-9-enyl (4R)-4-[(3R,10S,13R)-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 176937209 |
| Molecular Formula | C43H76O3 |
| Molecular Weight | 641.08 g/mol |
| Exact Mass | 640.58 |
| IUPAC Name | octadec-9-enyl (4R)-4-[(3R,10S,13R)-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(=O)CC[C@@H](C)C1CCC2C3CCC4C[C@H](OC)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C43H76O3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-32-46-41(44)27-22-34(2)38-25-26-39-37-24-23-35-33-36(45-5)28-30-42(35,3)40(37)29-31-43(38,39)4/h13-14,34-40H,6-12,15-33H2,1-5H3/t34-,35?,36-,37?,38?,39?,40?,42+,43-/m1/s1 |
| InChIKey | VFDOMKJVCUXIFH-JOKKWKRUSA-N |
| XLogP | 12.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.08 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|