C25H44O — CID 170098560
(3S,8R)-13-methyl-17-(5-methylhexyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 170098560) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is (3S,8R)-13-methyl-17-(5-methylhexyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R)-13-methyl-17-(5-methylhexyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 170098560 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | (3S,8R)-13-methyl-17-(5-methylhexyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCCCC1CCC2[C@@H]3CCC4C[C@@H](O)CCC4C3CCC12C |
| InChI | InChI=1S/C25H44O/c1-17(2)6-4-5-7-19-9-13-24-23-11-8-18-16-20(26)10-12-21(18)22(23)14-15-25(19,24)3/h17-24,26H,4-16H2,1-3H3/t18?,19?,20-,21?,22?,23+,24?,25?/m0/s1 |
| InChIKey | OMBXXVDSFFKPAV-SOYISAFGSA-N |
| XLogP | 6.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|