C25H44O2 — CID 167251636
(3S,8R,13R)-17-(2-hydroxy-5-methylhexyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 167251636) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is (3S,8R,13R)-17-(2-hydroxy-5-methylhexyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,13R)-17-(2-hydroxy-5-methylhexyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 167251636 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | (3S,8R,13R)-17-(2-hydroxy-5-methylhexyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC(O)CC1CCC2[C@@H]3CCC4C[C@@H](O)CCC4C3CC[C@]12C |
| InChI | InChI=1S/C25H44O2/c1-16(2)4-7-20(27)15-18-6-11-24-23-9-5-17-14-19(26)8-10-21(17)22(23)12-13-25(18,24)3/h16-24,26-27H,4-15H2,1-3H3/t17?,18?,19-,20?,21?,22?,23+,24?,25+/m0/s1 |
| InChIKey | OWPQWHHZYHIJSK-OPKABMEOSA-N |
| XLogP | 5.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |