C29H52O2 — CID 142521835
(17R)-17-(2-hydroxy-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;propane (PubChem CID 142521835) has the molecular formula C29H52O2 and a molecular weight of 432.73 g/mol. Its IUPAC name is (17R)-17-(2-hydroxy-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;propane.
| Compound Name | (17R)-17-(2-hydroxy-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;propane |
|---|---|
| PubChem CID | 142521835 |
| Molecular Formula | C29H52O2 |
| Molecular Weight | 432.73 g/mol |
| Exact Mass | 432.40 |
| IUPAC Name | (17R)-17-(2-hydroxy-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;propane |
| SMILES | CC(C)CCC(O)C[C@H]1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C.CCC |
| InChI | InChI=1S/C26H44O2.C3H8/c1-17(2)5-8-20(27)15-19-7-10-23-22-9-6-18-16-21(28)11-13-25(18,3)24(22)12-14-26(19,23)4;1-3-2/h6,17,19-24,27-28H,5,7-16H2,1-4H3;3H2,1-2H3/t19-,20?,21?,22?,23?,24?,25?,26?;/m1./s1 |
| InChIKey | BOPHWQWFADUDHQ-OLMKOZHYSA-N |
| XLogP | 7.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|