C27H44O2 — CID 167251765
17-[(2S)-3-cyclopentyl-2-hydroxypropyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 167251765) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is 17-[(2S)-3-cyclopentyl-2-hydroxypropyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-[(2S)-3-cyclopentyl-2-hydroxypropyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 167251765 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | 17-[(2S)-3-cyclopentyl-2-hydroxypropyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCC(O)CC1=CCC1C2CCC2(C)C(C[C@@H](O)CC3CCCC3)CCC12 |
| InChI | InChI=1S/C27H44O2/c1-26-13-11-21(28)16-19(26)7-9-23-24-10-8-20(27(24,2)14-12-25(23)26)17-22(29)15-18-5-3-4-6-18/h7,18,20-25,28-29H,3-6,8-17H2,1-2H3/t20?,21?,22-,23?,24?,25?,26?,27?/m0/s1 |
| InChIKey | DJIHDOMRJCMXMT-LOYVYENLSA-N |
| XLogP | 6.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|