C25H42O2 — CID 166170886
(17S)-17-(4-hydroxyhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 166170886) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is (17S)-17-(4-hydroxyhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (17S)-17-(4-hydroxyhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 166170886 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | (17S)-17-(4-hydroxyhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(O)CCC[C@H]1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C25H42O2/c1-4-19(26)7-5-6-17-9-11-22-21-10-8-18-16-20(27)12-14-25(18,3)23(21)13-15-24(17,22)2/h8,17,19-23,26-27H,4-7,9-16H2,1-3H3/t17-,19?,20?,21?,22?,23?,24?,25?/m0/s1 |
| InChIKey | ZMVAICLXQSHVPI-JZBJHPQTSA-N |
| XLogP | 5.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|