C24H37F3O2 — CID 168939429
(3S,10R)-10,13-dimethyl-17-(5,5,5-trifluoro-4-hydroxypentyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 168939429) has the molecular formula C24H37F3O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (3S,10R)-10,13-dimethyl-17-(5,5,5-trifluoro-4-hydroxypentyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R)-10,13-dimethyl-17-(5,5,5-trifluoro-4-hydroxypentyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 168939429 |
| Molecular Formula | C24H37F3O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | (3S,10R)-10,13-dimethyl-17-(5,5,5-trifluoro-4-hydroxypentyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCC3C(CC=C4C[C@@H](O)CC[C@@]43C)C1CCC2CCCC(O)C(F)(F)F |
| InChI | InChI=1S/C24H37F3O2/c1-22-13-11-20-18(8-6-16-14-17(28)10-12-23(16,20)2)19(22)9-7-15(22)4-3-5-21(29)24(25,26)27/h6,15,17-21,28-29H,3-5,7-14H2,1-2H3/t15?,17-,18?,19?,20?,21?,22?,23-/m0/s1 |
| InChIKey | SDAHICDYOLTPPC-QPDNUAPLSA-N |
| XLogP | 6.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|