C29H51F3O — CID 168938901
10,13-dimethyl-17-(5,5,5-trifluoro-4-methylpentyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane (PubChem CID 168938901) has the molecular formula C29H51F3O and a molecular weight of 472.72 g/mol. Its IUPAC name is 10,13-dimethyl-17-(5,5,5-trifluoro-4-methylpentyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane.
| Compound Name | 10,13-dimethyl-17-(5,5,5-trifluoro-4-methylpentyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane |
|---|---|
| PubChem CID | 168938901 |
| Molecular Formula | C29H51F3O |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | 10,13-dimethyl-17-(5,5,5-trifluoro-4-methylpentyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane |
| SMILES | CC.CC.CC(CCCC1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(F)(F)F |
| InChI | InChI=1S/C25H39F3O.2C2H6/c1-16(25(26,27)28)5-4-6-17-8-10-21-20-9-7-18-15-19(29)11-13-24(18,3)22(20)12-14-23(17,21)2;2*1-2/h7,16-17,19-22,29H,4-6,8-15H2,1-3H3;2*1-2H3 |
| InChIKey | BDGPNDGQJURGIO-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|