C22H33F3O2 — CID 170098793
(3S,8S,17R)-10,13-dimethyl-17-(3,3,3-trifluoro-2-hydroxypropyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 170098793) has the molecular formula C22H33F3O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is (3S,8S,17R)-10,13-dimethyl-17-(3,3,3-trifluoro-2-hydroxypropyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,17R)-10,13-dimethyl-17-(3,3,3-trifluoro-2-hydroxypropyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 170098793 |
| Molecular Formula | C22H33F3O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (3S,8S,17R)-10,13-dimethyl-17-(3,3,3-trifluoro-2-hydroxypropyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CC[C@H](O)CC1=CC[C@@H]1C2CCC2(C)C1CC[C@@H]2CC(O)C(F)(F)F |
| InChI | InChI=1S/C22H33F3O2/c1-20-9-7-15(26)11-13(20)3-5-16-17-6-4-14(12-19(27)22(23,24)25)21(17,2)10-8-18(16)20/h3,14-19,26-27H,4-12H2,1-2H3/t14-,15+,16+,17?,18?,19?,20?,21?/m1/s1 |
| InChIKey | XDEHTCFCUFCYCS-KMUYXPTJSA-N |
| XLogP | 5.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|