C25H40F2O2 — CID 144728651
(13R,17R)-17-(3,3-difluoro-4-hydroxy-4-methylpentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 144728651) has the molecular formula C25H40F2O2 and a molecular weight of 410.59 g/mol. Its IUPAC name is (13R,17R)-17-(3,3-difluoro-4-hydroxy-4-methylpentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (13R,17R)-17-(3,3-difluoro-4-hydroxy-4-methylpentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 144728651 |
| Molecular Formula | C25H40F2O2 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | (13R,17R)-17-(3,3-difluoro-4-hydroxy-4-methylpentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCC(O)CC1=CCC1C2CC[C@@]2(C)C1CC[C@@H]2CCC(F)(F)C(C)(C)O |
| InChI | InChI=1S/C25H40F2O2/c1-22(2,29)25(26,27)14-9-16-6-8-20-19-7-5-17-15-18(28)10-12-24(17,4)21(19)11-13-23(16,20)3/h5,16,18-21,28-29H,6-15H2,1-4H3/t16-,18?,19?,20?,21?,23-,24?/m1/s1 |
| InChIKey | YRLSVLVKAMSYSM-JPWMBQPQSA-N |
| XLogP | 6.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|