C26H43BO2 — CID 145398696
CID 145398696 (PubChem CID 145398696) has the molecular formula C26H43BO2 and a molecular weight of 398.44 g/mol.
| Compound Name | CID 145398696 |
|---|---|
| PubChem CID | 145398696 |
| Molecular Formula | C26H43BO2 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | — |
| SMILES | [B]C(O)(CCCC1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C26H43BO2/c1-17(2)26(27,29)13-5-6-18-8-10-22-21-9-7-19-16-20(28)11-14-25(19,4)23(21)12-15-24(18,22)3/h7,17-18,20-23,28-29H,5-6,8-16H2,1-4H3 |
| InChIKey | YSUYXVBGBILPFJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|