C26H42O — CID 145061972
(17S)-10,13-dimethyl-17-(4-methylhex-5-enyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 145061972) has the molecular formula C26H42O and a molecular weight of 370.62 g/mol. Its IUPAC name is (17S)-10,13-dimethyl-17-(4-methylhex-5-enyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (17S)-10,13-dimethyl-17-(4-methylhex-5-enyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 145061972 |
| Molecular Formula | C26H42O |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | (17S)-10,13-dimethyl-17-(4-methylhex-5-enyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=CC(C)CCC[C@H]1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C26H42O/c1-5-18(2)7-6-8-19-10-12-23-22-11-9-20-17-21(27)13-15-26(20,4)24(22)14-16-25(19,23)3/h5,9,18-19,21-24,27H,1,6-8,10-17H2,2-4H3/t18?,19-,21?,22?,23?,24?,25?,26?/m0/s1 |
| InChIKey | POQCAERKLNMLOK-ZZHNVIGTSA-N |
| XLogP | 6.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|