C26H42O2 — CID 145230772
(8S)-17-(4-cyclopropyl-4-hydroxybutyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 145230772) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is (8S)-17-(4-cyclopropyl-4-hydroxybutyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S)-17-(4-cyclopropyl-4-hydroxybutyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 145230772 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | (8S)-17-(4-cyclopropyl-4-hydroxybutyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCC(O)CC1=CC[C@@H]1C2CCC2(C)C(CCCC(O)C3CC3)CCC12 |
| InChI | InChI=1S/C26H42O2/c1-25-15-13-23-21(10-8-19-16-20(27)12-14-26(19,23)2)22(25)11-9-18(25)4-3-5-24(28)17-6-7-17/h8,17-18,20-24,27-28H,3-7,9-16H2,1-2H3/t18?,20?,21-,22?,23?,24?,25?,26?/m0/s1 |
| InChIKey | HOJLFHDQZSJDOY-UHDNZWNSSA-N |
| XLogP | 5.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|