C28H50O2 — CID 145230534
ethane;(3S,8S,10R)-17-[(5S)-6-hydroxy-5-methylhexyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 145230534) has the molecular formula C28H50O2 and a molecular weight of 418.71 g/mol. Its IUPAC name is ethane;(3S,8S,10R)-17-[(5S)-6-hydroxy-5-methylhexyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | ethane;(3S,8S,10R)-17-[(5S)-6-hydroxy-5-methylhexyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 145230534 |
| Molecular Formula | C28H50O2 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.38 |
| IUPAC Name | ethane;(3S,8S,10R)-17-[(5S)-6-hydroxy-5-methylhexyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC.C[C@H](CO)CCCCC1CCC2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)C3CCC12C |
| InChI | InChI=1S/C26H44O2.C2H6/c1-18(17-27)6-4-5-7-19-9-11-23-22-10-8-20-16-21(28)12-14-26(20,3)24(22)13-15-25(19,23)2;1-2/h8,18-19,21-24,27-28H,4-7,9-17H2,1-3H3;1-2H3/t18-,19?,21-,22-,23?,24?,25?,26-;/m0./s1 |
| InChIKey | HWSHHRDGYVBNOH-PPFXUUKKSA-N |
| XLogP | 7.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|