C27H44O — CID 144728831
(3S)-3,10,13-trimethyl-17-(4-methylhex-5-enyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 144728831) has the molecular formula C27H44O and a molecular weight of 384.65 g/mol. Its IUPAC name is (3S)-3,10,13-trimethyl-17-(4-methylhex-5-enyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S)-3,10,13-trimethyl-17-(4-methylhex-5-enyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 144728831 |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | (3S)-3,10,13-trimethyl-17-(4-methylhex-5-enyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C=CC(C)CCCC1CCC2C3CC=C4C[C@@](C)(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H44O/c1-6-19(2)8-7-9-20-11-13-23-22-12-10-21-18-25(3,28)16-17-27(21,5)24(22)14-15-26(20,23)4/h6,10,19-20,22-24,28H,1,7-9,11-18H2,2-5H3/t19?,20?,22?,23?,24?,25-,26?,27?/m0/s1 |
| InChIKey | QNWFFPWILZUKPO-WUYYPQJBSA-N |
| XLogP | 7.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|