C28H40O2S — CID 134395055
(3S)-17-[2-(benzenesulfinyl)ethyl]-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 134395055) has the molecular formula C28H40O2S and a molecular weight of 440.69 g/mol. Its IUPAC name is (3S)-17-[2-(benzenesulfinyl)ethyl]-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S)-17-[2-(benzenesulfinyl)ethyl]-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134395055 |
| Molecular Formula | C28H40O2S |
| Molecular Weight | 440.69 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | (3S)-17-[2-(benzenesulfinyl)ethyl]-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CC[C@](C)(O)CC1=CCC1C2CCC2(C)C(CCS(=O)c3ccccc3)CCC12 |
| InChI | InChI=1S/C28H40O2S/c1-26(29)16-17-28(3)21(19-26)9-11-23-24-12-10-20(27(24,2)15-13-25(23)28)14-18-31(30)22-7-5-4-6-8-22/h4-9,20,23-25,29H,10-19H2,1-3H3/t20?,23?,24?,25?,26-,27?,28?,31?/m0/s1 |
| InChIKey | IAOPKUYNIXYIPC-YMXCNSFYSA-N |
| XLogP | 6.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|