C23H40O2Si — CID 67788143
(8R,9R,10R,13S,14S)-3,10,13-trimethyl-17-trimethylsilyloxy-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 67788143) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-3,10,13-trimethyl-17-trimethylsilyloxy-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9R,10R,13S,14S)-3,10,13-trimethyl-17-trimethylsilyloxy-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67788143 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (8R,9R,10R,13S,14S)-3,10,13-trimethyl-17-trimethylsilyloxy-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC1(O)CC[C@@]2(C)C(=CC[C@@H]3[C@H]2CC[C@]2(C)C(O[Si](C)(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H40O2Si/c1-21(24)13-14-22(2)16(15-21)7-8-17-18-9-10-20(25-26(4,5)6)23(18,3)12-11-19(17)22/h7,17-20,24H,8-15H2,1-6H3/t17-,18-,19+,20?,21?,22-,23-/m0/s1 |
| InChIKey | CENDBTUSYWLFOW-LFIUMIKYSA-N |
| XLogP | 5.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|