C29H40O3 — CID 166170884
[(1S)-1-[(3S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl] benzoate (PubChem CID 166170884) has the molecular formula C29H40O3 and a molecular weight of 436.64 g/mol. Its IUPAC name is [(1S)-1-[(3S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl] benzoate.
| Compound Name | [(1S)-1-[(3S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl] benzoate |
|---|---|
| PubChem CID | 166170884 |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | [(1S)-1-[(3S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl] benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1)C1CCC2C3CC=C4C[C@@](C)(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C29H40O3/c1-19(32-26(30)20-8-6-5-7-9-20)23-12-13-24-22-11-10-21-18-27(2,31)16-17-28(21,3)25(22)14-15-29(23,24)4/h5-10,19,22-25,31H,11-18H2,1-4H3/t19-,22?,23?,24?,25?,27-,28?,29?/m0/s1 |
| InChIKey | ZOOUPKHXFIPMMF-PCAWHDPLSA-N |
| XLogP | 6.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|