C26H42O2 — CID 176721043
(5R)-5-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,13-dimethyl-10-(trideuteriomethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]hexan-2-one (PubChem CID 176721043) has the molecular formula C26H42O2 and a molecular weight of 389.64 g/mol. Its IUPAC name is (5R)-5-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,13-dimethyl-10-(trideuteriomethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]hexan-2-one.
| Compound Name | (5R)-5-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,13-dimethyl-10-(trideuteriomethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]hexan-2-one |
|---|---|
| PubChem CID | 176721043 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 389.64 g/mol |
| Exact Mass | 389.34 |
| IUPAC Name | (5R)-5-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,13-dimethyl-10-(trideuteriomethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]hexan-2-one |
| SMILES | [2H]C([2H])([2H])[C@]12CC[C@](C)(O)CC1=CC[C@H]1[C@@H]3CC[C@H]([C@H](C)CCC(C)=O)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C26H42O2/c1-17(6-7-18(2)27)21-10-11-22-20-9-8-19-16-24(3,28)14-15-25(19,4)23(20)12-13-26(21,22)5/h8,17,20-23,28H,6-7,9-16H2,1-5H3/t17-,20+,21-,22+,23+,24+,25+,26-/m1/s1/i4D3 |
| InChIKey | COFIXGYPTCQMPE-MMOKVAPMSA-N |
| XLogP | 6.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|