C28H47O2- — CID 172574910
(6R)-6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-olate (PubChem CID 172574910) has the molecular formula C28H47O2- and a molecular weight of 415.68 g/mol. Its IUPAC name is (6R)-6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-olate.
| Compound Name | (6R)-6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-olate |
|---|---|
| PubChem CID | 172574910 |
| Molecular Formula | C28H47O2- |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 415.36 |
| IUPAC Name | (6R)-6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-olate |
| SMILES | C[C@H](CCCC(C)(C)[O-])[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H47O2/c1-19(8-7-14-25(2,3)29)22-11-12-23-21-10-9-20-18-26(4,30)16-17-27(20,5)24(21)13-15-28(22,23)6/h9,19,21-24,30H,7-8,10-18H2,1-6H3/q-1/t19-,21+,22-,23+,24+,26+,27+,28-/m1/s1 |
| InChIKey | ZOGDYYIGWHXMEX-LTOXSCOASA-N |
| XLogP | 6.26 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|