C26H41F3O2 — CID 138604567
(3S,8S,9S,10R,13R,14S)-3,10,13-trimethyl-17-[(2R)-6,6,6-trifluoro-5-hydroxyhexan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 138604567) has the molecular formula C26H41F3O2 and a molecular weight of 442.61 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S)-3,10,13-trimethyl-17-[(2R)-6,6,6-trifluoro-5-hydroxyhexan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S)-3,10,13-trimethyl-17-[(2R)-6,6,6-trifluoro-5-hydroxyhexan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 138604567 |
| Molecular Formula | C26H41F3O2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S)-3,10,13-trimethyl-17-[(2R)-6,6,6-trifluoro-5-hydroxyhexan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCC(O)C(F)(F)F)C1CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H41F3O2/c1-16(5-10-22(30)26(27,28)29)19-8-9-20-18-7-6-17-15-23(2,31)13-14-24(17,3)21(18)11-12-25(19,20)4/h6,16,18-22,30-31H,5,7-15H2,1-4H3/t16-,18+,19?,20+,21+,22?,23+,24+,25-/m1/s1 |
| InChIKey | RTNUUNWEXMZDCZ-RNOYTOKYSA-N |
| XLogP | 6.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|