C27H43F3O2 — CID 123158715
3-ethyl-10,13-dimethyl-17-(6,6,6-trifluoro-5-hydroxyhexan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 123158715) has the molecular formula C27H43F3O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 3-ethyl-10,13-dimethyl-17-(6,6,6-trifluoro-5-hydroxyhexan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 3-ethyl-10,13-dimethyl-17-(6,6,6-trifluoro-5-hydroxyhexan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 123158715 |
| Molecular Formula | C27H43F3O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 3-ethyl-10,13-dimethyl-17-(6,6,6-trifluoro-5-hydroxyhexan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCC1(O)CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCC(O)C(F)(F)F)CCC32)C1 |
| InChI | InChI=1S/C27H43F3O2/c1-5-26(32)15-14-24(3)18(16-26)7-8-19-21-10-9-20(25(21,4)13-12-22(19)24)17(2)6-11-23(31)27(28,29)30/h7,17,19-23,31-32H,5-6,8-16H2,1-4H3 |
| InChIKey | WRWPNZJNPRSDSN-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|